Which of the following represents the chemical reaction of benzene and nitric acid to produce nitrobenzene and water?

Answer:

the earth is tilted towards the sun

Explanation:

In the context, there is a sun and earth system and at a certain point when the earth is moving in its orbit around he sun, some point on the earth experiences the summers season. This is because at this point of the earths revolution, the point on the earth is facing the sun and is also tilted towards the sun. So at this point the sun rays fall directly at the surface. While the place which is tilted away from the sun, experiences winter season.

Answer:

Earth's northern hemisphere is tilted toward the Sun.

Answer:

Option (a) is the correct answer.

Explanation:

The law of conservation of energy states that energy can neither be created nor it can be destroyed. It can only be transformed from one form to another.

Therefore, the total amount of energy before and after a chemical reaction is the same. Thus, energy is conserved.

Therefore, we can conclude that option (a) is the correct answer.

Answer:

conserved

Explanation:

law of conservation of energy says that energy can neither be created or destroyed

Answer:

P₂ = 1.37

Explanation:

Given data:

Initial pressure = 1.15 atm

Initial temperature = 23°C (23+273= 296 K)

Final pressure = ?

Final temperature = 79°C (79+273=352 K)

Solution:

According to Gay-Lussac Law,

The pressure of given amount of a gas is directly proportional to its temperature at constant volume and number of moles.

Mathematical relationship:

P₁/T₁ = P₂/T₂

Now we will put the values in formula:

1.15 atm / 296 K = P₂/352 K

P₂ = 1.15 atm × 352 K / 296 K

P₂ = 404.8 atm. K /296 K

P₂ = 1.37 atm

Answer:

Explanation:

To find the number of moles in a substance given it's number of entities we use the formula

[tex]n = \frac{N}{L} \\ [/tex]

where n is the number of moles

N is the number of entities

L is the Avogadro's constant which is

6.02 × 10²³ entities

From the question we have

[tex]n = \frac{1.49 \times {10}^{23} }{6.02 \times {10}^{23} } = \frac{1.49}{6.02} \\ = 0.247508305...[/tex]

We have the final answer as

Hope this helps you

Answer:

18 mol NH₃

General Formulas and Concepts:

Chemistry - Stoichiometry

Explanation:

Step 1: Define

RxN:   N₂ (g) + 3H₂ (g) → 2NH₃ (g)

Given:   27 moles H₂

Step 2: Stoichiometry

[tex]27 \ mol \ H_2(\frac{2 \ mol \ NH_3}{3 \ mol \ H_2} )[/tex] = 18 mol NH₃

Step 3: Check

We are given 2 sig figs.

Since our final answer is in 2 sig figs, we do not need to round.

Answer:

No and yes

Explanation:

Xenon is a noble gas and beryllium is a metal

Answer: no and yes i also agree

Xenon is a noble gas and Beryllium a metal

Explanation:

Answer:

However, when formal units are used to measure length, the measurement can usually be read from a scale on a ruler or tape, which shows units of a particular size. Unit iteration involves knowledge of repeatedly placing identical tightly packing units so that there are no overlaps or gaps.

Explanation:

Answer:

C stays The same.

Is the answer.

Answer: C (1)

Explanation:

H is only the element hydrogen.

Answer: Water inside the seed coat creating a pushing force, breaking the seed coat.

Explanation:

Seed germination can be defined as the process by which a new plant emerge out from a seed. The radicle is the first emerging part from a seed and it develops into a root and the plumule is the second emerging part and it develops into a shoot. The light, water, adequate temperature, and soil are the factors that are necessary for seed germination.

According to a given situation, the popcorn kernel will receive the moisture necessary for the germination process, the water will imbibe into the seed coat creating pressure inside the seed and which will cause the seed coat to break and the new plant parts or seedling will emerge out of the seed coat.

The molarity of a hydrochloric acid solution : 0.32 M

Titration is a procedure for determining the concentration of a solution by reacting with another solution which is known to be concentrated (usually a standard solution).

Titrations can be distinguished including acid-base titration, depositional titration, and redox titration. An acid-base titration is the principle of neutralization of acids and bases is used.  

Acid-base titration formula  

Ma. Va. na = Mb. Vb. nb  

Ma, Mb = acid base concentration  

Va, Vb = acid base volume  

na, nb = acid base valence  

1 ⇒HCl (valence=1, HCl ⇒H⁺+Cl⁻, one H⁺)

2⇒Ca(OH)₂(valence=2, Ca(OH)₂⇒Ca²⁺+2OH⁻, two OH⁻)

M₂=0.1 M

V₂=48 ml=0.048 L

V₁=30 ml=0.03 L

[tex]\tt M_1.V_1.n_1=M_2.V_2.n_2\\\\M_1\times 0.03\times 1=0.1\times 0.048\times 2\\\\M_1=0.32[/tex]

Answer:

Test 2

Explanation:

............................................

Answer:

(B) Test 2

Explanation:

The entire substance changed, and turned into a liquid.

Answer:

An object that is at rest will stay at rest unless a force acts upon it. An object that is in motion will not change its velocity unless a force acts upon it. This is known as uniform motion. An object continues to do whatever it happens to be doing unless a force is exerted upon it.

Explanation: NEWTONS laws of motion

Answer:

15 sec

Explanation:

Answer:

The speed of the car is 75 km per hour

Explanation:

Speed is distance over time so 150 km divided by 2 hours is 75km per hour.

Please mark brainliest!!! Thanks.

Answer:

24 atoms

Explanation:

4+10+5+5

Answer:

2.00 L of a gas is collected at 25.0°C and 745.0 mmHg. What is the volume at STP? STP is a common abbreviation for "standard temperature and pressure." You have to recognize that five values are given in the problem and the sixth is an x. Also ... 273 1. A gas has a volume of 800.0 mL at minus 23.00 °C and 300.0 torr.

Explanation:

Answer:

the answer is letter B. the entropy

Answer:

Yes, Copper (Cu) in its pure form is a reddish-brown metallic element with high ductility and malleability that is an excellent conductor of heat and electricity: atomic weight 63.54; atomic number 29; density 8.94 g/cm3; melting point 1083°C; and boiling point 2595°C.

Answer:

no ,its not malleable

Explanation:

copper II sulphate is a blue compound , which is brittle solid , crystalline .

copper metal is malleable and ductile

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

Answer:

Nano silver is woven into fabric to give it anti-bacterial properties.

Explanation:

Helps by fending off the bacteria that make those clothes smell after you sweat. Nano-titanium dioxide adds sun protection to clothing just as it does in sunscreen. The use of nanoparticles to achieve fresh-smelling clothes and UV protection may not be safe.

Answer:yup!!

Explanation:

Answer:

Leroy Jeakins

Explanation:

Catus jack f me in the asss

The elements do all the “s” orbital span (go across) in each period is 2. Thus option a is correct.

Elements are defined as  a pure substance made up of only one sort of atom with the same number of protons in its nucleus.

It can also be defined as the a substance that can't be broken down into anything else.

Sublevels are defined as a quantum theory-defined energy level Sublevels are energies associated with electrons in chemistry.

There are mainly four sublevels

Thus, the elements do all the “s” orbital span (go across) in each period is 2. Thus option a is correct.

To learn more about elements, refer to the link below:

https://brainly.com/question/13025901

#SPJ2

Answer:

Chlorine

Explanation:

Even though chlorine is highly electronegative, the best answer is no, and in this class we will consider chlorine not to form hydrogen bonds (even though it has the same electronegativity as oxygen). This is because chlorine is large and its lone electron is in a diffuse orbital, covering a large area, and thus do not have the high charge density to act as a strong hydrogen bond acceptor. But it does form weak hydrogen bonds in solid crystalline hydrogen chloride at very low temperatures.

Answer: 4 hydrogens

Explanation:

This is what the structure will look like C=C. Remember that it's important that all structures have a complete octet. As it looks right now each carbon is sharing 4 valence electrons so each needs 2 more bonds to hydrogen complete its octet.

Answer: 4 hydrogens

Explanation:

Answer:

chemistry

Explanation:

Answer:

The properties of compounds are different from the properties of the elements that form the compounds.

Explanation:

When elements form compounds, their properties are significantly modified. The physical and chemical properties of compounds and that of the elements that compose them are significantly different.

The introduction of chemical bonds between different atoms in compounds make the compounds to differ from elements where the atoms are bonded to atoms of the same element.

Answer:

It is false :l

Explanation:

Pahoehoe is a smooth and continuous lava crust. Pahoehoe forms when the effusion rate is low and consequently the velocity of lava flow is slow. Pahoehoe lava flow is usually at least 10 times slower than typical aa lava flow.

:/