Answer 5x + 8 − 3x = −10

Answers

Answer 1

Answer:

-9

Step-by-step explanation:

5x+8-3x = -10

Combine like terms

2x+8 = -10

Subtract 8 to both sides

2x = -18

Divide both sides by 2

x = -9

Answer 2

Answer:

-9

Step-by-step explanation:

5x + 8 - 3x = -10

Combine like terms

2x + 8 = -10

Subtract 8 to both sides

2x = -18

Divide both sides by 2

x = -9


Related Questions

From an urn containing 3 white and 2 black balls, two balls are drawn one after the other without replacement. What is the probability that the first ball drawn is white and the second black?

Answers

Answer:

There is a 3/5 chance of the first ball being white, and a 3/10 chance the second one is black.

Step-by-step explanation:

There are 5 balls, of which 3 are white, so you have a 3/5 chance of the first one being white. Then you have 2 white and 2 black balls. There is a 2/4 chance of picking a black ball. Multiply 3/5 and 2/4 to get 6/20, or 3/10 for choosing a white ball then a black ball.

Use z scores to compare the given values. The tallest living man at one time had a height of 252 cm. The shortest living man at that time had a height of 79.2 cm. Heights of men at that time had a mean of 176.74 cm and a standard deviation of 8.06 cm. Which of these two men had the height that was moreâ extreme?

Answers

Answer:

The more extreme height was the case for the shortest living man at that time (12.1017 standard deviation units below the population's mean) compare with the tallest living man (at that time) that was 9.3374 standard deviation units above the population's mean.

Step-by-step explanation:

To answer this question, we need to use standardized values, and we can obtain them using the formula:

[tex] \\ z = \frac{x - \mu}{\sigma}[/tex] [1]  

Where

x is the raw score we want to standardize.[tex] \\ \mu[/tex] is the population's mean.[tex] \\ \sigma[/tex] is the population standard deviation.

A z-score "tells us" the distance from [tex] \\ \mu[/tex] in standard deviation units, and a positive value indicates that the raw score is above the mean and a negative that the raw score is below the mean.

In a normal distribution, the more extreme values are those with bigger z-scores, above and below the mean. We also need to remember that the normal distribution is symmetrical.

Heights of men at that time had:

[tex] \\ \mu = 176.74[/tex] cm.[tex] \\ \sigma = 8.06[/tex] cm

Let us see the z-score for each case:

Case 1: The tallest living man at that time

The tallest man had a height of 252 cm.

Using [1], we have (without using units):

[tex] \\ z = \frac{x - \mu}{\sigma}[/tex]

[tex] \\ z = \frac{252 - 176.74}{8.06}[/tex]

[tex] \\ z = \frac{75.26}{8.06}[/tex]

[tex] \\ z = 9.3374[/tex]  

That is, the tallest living man was 9.3374 standard deviation units above the population's mean.

Case 2: The shortest living man at that time

The shortest man had a height of 79.2 cm.

Following the same procedure as before, we have:

[tex] \\ z = \frac{x - \mu}{\sigma}[/tex]

[tex] \\ z = \frac{79.2 - 176.74}{8.06}[/tex]

[tex] \\ z = \frac{-97.54}{8.06}[/tex]

[tex] \\ z = -12.1017[/tex]

That is, the shortest living man was 12.1017 standard deviation units below the population's mean (because of the negative value for the standardized value.)

The normal distribution is symmetrical (as we previously told). The height for the shortest man was at the other extreme of the normal distribution in [tex] \\ 12.1017 - 9.3374 = 2.7643[/tex] standard deviation units more than the tallest man.

Then, the more extreme height was the case for the shortest living man (12.1017 standard deviation units below the population's mean) compare with the tallest man that was 9.3374 standard deviation units above the population's mean.

Find the lengths of the 2 Missing sides of each triangle

Answers

Green

x=14.7

y=8.5

Red

x=3.5

y=6

Which is the population standard deviation of the data set: 53, 35, 40, 38, 42

Answers

Answer:

daddy wants some more dior

Step-by-step explanation:

Inflation causes things to cost more, and for our money to buy less (hence your grandparents saying "In my day, you could buy a cup of coffee for a nickel"). Suppose inflation decreases the value of money by 4% each year. In other words, if you have $1 this year, next year it will only buy you $0.96 worth of stuff. How much will $100 buy you in 25 years?

Answers

Answer:

Step-by-step explanation:

[tex]100 (0.96)^{25} =[/tex] around 36.04


A classic counting problem is to determine the number of different ways that the letters of "misspell" can be arranged. Find that number.

Answers

Answer:

10,080 different ways that the letters of "misspell" can be arranged.

Step-by-step explanation:

Number of arrangents of the letters of a word:

A word has n letters.

The are m repeating letters, each of them repeating [tex]r_{0}, r_{1}, ..., r_{m}[/tex] times

So the number of distincts ways the letters can be arranged is:

[tex]N_{A} = \frac{n!}{r_{1}! \times r_{2}! \times ... \times r_{m}}[/tex]

In this question:

Misspell has 8 letters, with s and l repeating twice.

So

[tex]N_{A} = \frac{8!}{2!2!} = 10080[/tex]

10,080 different ways that the letters of "misspell" can be arranged.

The radius of inscribed circle is 10 what is the perimeter of square cabd

Answers

Answer:

P=80

Step-by-step explanation:

R= 10  

P = R*2 *4

P of a square = 10*2 *4 = 80

Just divide by any fraction of the squares ratio.

ie) if square = 2/3 of the length of the circle then 80 x 2/3 = 53.333...

ie) if square = 3/4 of the length of the diameter of the circle then 80 x 3/4 = 60

As 3/4 pf 10 = 7.5

7.5 * 2  = 15

15* 4 = 60

Howver the square is outside of the circle as described circle inscribed exactly how much if it fits exactly then the length will be same as circles diameter = 10*2 = D;20.

20 *4 = 80. P;80

Etc.

b) A man purchased 5 dozen of eggs at Rs 5 each. 10 eggs were broken and he
sold the remaining at Rs 5.70 each. Find
(ii) Profit or loss percent.
(i) his total profit or loss.​

Answers

Answer:

Dear User,

Answer to your query is provided below

(i) Total Loss = Rs.15

(ii) Loss percent = 5%

Step-by-step explanation:

Eggs purchased = 5x12 = 60

Total Cost = 60x5 = Rs 300

Eggs Broken = 10

Eggs Broken cost = 10x5= Rs. 50

Eggs sold = 60-10 = 50

Egg Sale cost = 50x5.70 = Rs 285

(i) Total Loss = C.p. - S.p. = 300 - 285 = 15

(ii) Loss Percent = (Loss/CP)x100 = (15/300)x100 = 5%

It has been suggested that night shift-workers show more variability in their output levels than day workers. Below, you are given the results of two independent random samples.

Night Shift (N) Day Shift (D)
Sample Size 9 8
Sample Mean 520 540
Sample Variance 38 20

Required:

a. At 95% confident level, what is the critical value?
b. State the null and alternative hypotheses to be tested.
c. Compute the test statistic.
d. Determine the p-value.

Answers

Answer:

Null hypotheses = H₀ = σ₁² ≤ σ₂²

Alternative hypotheses = Ha = σ₁² > σ₂²

Test statistic = 1.9

p-value = 0.206

Since the p-value is greater than α therefore, we cannot reject the null hypothesis.

So we can conclude that the night shift workers don't show more variability in their output levels than day workers.

Step-by-step explanation:

Let σ₁² denotes the variance of night shift-workers

Let σ₂² denotes the variance of day shift-workers

State the null and alternative hypotheses:

The null hypothesis assumes that the variance of night shift-workers is equal to or less than day-shift workers.

Null hypotheses = H₀ = σ₁² ≤ σ₂²

The alternate hypothesis assumes that the variance of night shift-workers is more than day-shift workers.

Alternative hypotheses = Ha = σ₁² > σ₂²

Test statistic:

The test statistic or also called F-value is calculated using

Test statistic = Larger sample variance/Smaller sample variance

The larger sample variance is σ₁² = 38

The smaller sample variance is σ₂² = 20

Test statistic = σ₁²/σ₂²

Test statistic = 38/20

Test statistic = 1.9

p-value:

The degree of freedom corresponding to night shift workers is given by

df₁ = n - 1

df₁ = 9 - 1

df₁ = 8

The degree of freedom corresponding to day shift workers is given by

df₂ = n - 1

df₂ = 8 - 1

df₂ = 7

We can find out the p-value using F-table or by using Excel.

Using Excel to find out the p-value,

p-value = FDIST(F-value, df₁, df₂)

p-value = FDIST(1.9, 8, 7)

p-value = 0.206

Conclusion:

p-value > α    

0.206 > 0.05   ( α = 1 - 0.95 = 0.05)

Since the p-value is greater than α therefore, we cannot reject the null hypothesis corresponding to a confidence level of 95%

So we can conclude that the night shift workers don't show more variability in their output levels than day workers.

if a-2= (2^2/3+2^1/3) find a^3-6a^2+12a-14​

Answers

Answer:

Step-by-step explanation:

7. 1, for r = 0 - 1, for r = 1 Hence, determine alo. Using characteristic root ... find the solution of the recurrence relation y, + 9 y, 2 = 6y, 1, subjected to the ... Solve a, -5a, 1 + 6a, 2 = 0 , given initial conditions ao = 2 and a1 = 5. ... Solve the recurrence relation a, – 7a, 1 + 16a, 2 – 12a, 3 = 0 for n > 3 with ... 2"; 3. a = (2)” – n.

Answer:

2

Step-by-step explanation:

I solved in the picture

Hope this helps ^-^

lucy buys 3 liters of apple juice. How many millilitres of apple juice does she buy?

*please help*​

Answers

Answer:

3000 milliliters

Step-by-step explanation:

1liter contains 1000militers

3liters contain (3*1000)militers

Answer:

3000 millilitres

Step-by-step explanation:

since 1 litre = 1000 millimetres

3 litres will be equal to 1000 x 3 = 3000 ml

g Suppose the company operates mine​ #1 for x1 days and mine​ #2 for x2 days. Write a vector equation in terms of v1 and v2 whose solution gives the number of days each mine should operate in order to produce 296 tons of copper and 2454 kilograms of silver. Do not solve the equation.

Answers

Answer:

The vector equation in terms of v1 and v2 is x₁v₁ +x₂v₂ = [296 2454]

Step-by-step explanation:

Solution

The aim is to write down a vector equation in terms of v1 and v2, when solution gives the number of days each mine should operate in order to produce 296 tons of copper and 2454 kilograms of silver.

Thus,

Suppose that b = [ 296 2454] is the corresponding vector which is representing the total needed output.

Now,

If the company operates mine 1 for x1 days and mine​ #2 for x2 days

Then,

The total output becomes x₁v₁ +x₂v₂ which is the same output to  b = [296 2454]

Hence, x₁ and x₂ should be satisfactory to the needed vector equation x₁v₁ +x₂v₂ = [296 2454]

So, the vector equation becomes  x₁v₁ +x₂v₂ = [296 2454]

find an angle x where sin x = cos x (I know this has been answered but I rlly don't get it..)​

Answers

Answer:

45 degrees

Step-by-step explanation:

sin x=cos(90-x)

sin(45)=cos(90-45)=cos(45)

Answer:

The answer is 45.

sin45=cos45= 1/√2.

hope it helps u ...

which situation cannot be represented by this expression 13+8
A Ben gave 8 of his bagels to friends. Now he has 13 left. How many bagels did he start with?
B Jack bought 8 books. He will buy 13 more. How many books will he buy altogether?
C Zoe is reading an article with 13 pages. She has 8 pages left. How many pages has she read?
D Caleb swam for 13 minutes. Then he swam for 8 more minutes. For how many minutes did he swim?

Answers

D because Caleb had swam 8 more after swimming 13

Saved
250 mg
sing value in
50 mg
10 ml
X
Choice

Answers

Hi there!

What is the question and then i can help!

which is pattern 12,24,36,48

Answers

t(n)=n×12, where n=the nth term in the sequence and where 12=a constant. always by 12

Answer:

multiples of 12

Step-by-step explanation: when looking at the GCF, the answer is 12

When each of the following is divided by 8, only ?_ has a remainder that is a prime number. A) 548 B) 569 C) 678 D) 778

Answers

Answer:

the answer you are looking for is D 778

WILL GIVE BRAINLIEST IF ANSWERED NOW
Write an equation of a line that passes through the point (3, 2) and is parallel to the line y = 3x +7
y = 3x -7
y = 1/3x+2
y= 1/3x-2

Answers

Answer:

y=3x-7

Step-by-step explanation:

lines are parallel hence gradient from the equation in question is the same as the gradient of the equation to be found.. comparing to y=mx+c, eq in question has grad 3... from the formula y-y1=m(x-x1) where (x1,y1) is equal to the point in question

Answer:

Make That Guy Brainliest Now ^^^^^    You can now that there are two answers!

PLEASE ANSWER THIS!
In the diagram, PQRS, JQK and LRK are straight lines
Р
Question 1
Question 2
Question 3
J-
2yQ
Question 4
O
x
K
Question 5
Question 6
Question 7
Question 8
Question 9
M
33°
DO
R
L
2x/
Question 10
S
What is the size of the angle JKL?
Question 11
Question 12
Question 13
Question 14
A Question 15
Question 16
Question 17
Question 18
Question 19
37°
38°
36°
34°
35°

Answers

Answer:

  38°

Step-by-step explanation:

The sum of angles that make a line is 180°; the sum of angles in a triangle is 180°. So, we have the following relations:

  2x +y +A = 180

  2y +x + B = 180

  A +B +33 = 180

Adding the first two equations and subtracting the third, we get ...

  (2x +y +A) +(2y +x +B) -(A +B +33) = 180 +180 -180

  3x +3y -33 = 180

  x + y - 11 = 60

  x + y = 71

__

We know vertical angles are congruent, so in triangle QRK, we have ...

  2y +2x +∠K = 180

  ∠K = 180 -2x -2y = 180 -2(x +y) = 180 -2(71)

  ∠JKL = 38°

Answer:

38 degrees

Step-by-step explanation:

Please answer this correctly

Answers

Answer:

Area of the figure = 169.5 yards²

Step-by-step explanation:

Area of Rectangle = Length × Width

Area of triangle = 1/2(base × height)

We'll divide the whole figure into parts so that we can find the area more easily!

Rectangle 1 (uppermost):

10 × 4 = 40 yards²

Square 1 (right below the rectangle 1):

7 × 7 = 49 yards²

Rectangle 2 (with square 1):

7 × 3 = 21 yards²

Triangle 1 (Below rectangle 2):

1/2(17 × 7) = 119/2 = 59.5 yards²

Now adding up all to get the area of the whole figure:

Area of the figure = 40 + 49 + 21 + 59.5

Area of the figure = 169.5 yards²

Please answer this correctly

Answers

Answer: 30

Step-by-step explanation:

Q1: 120

Q3: 150

To find the interquartile range, subtract Q1 from Q3, which is 150-120. Therefore, the interquartile range  of the kitten's weight, is 30

Answer: 30 grams

Step-by-step explanation:

The interquartile range is the range within the boxed areaa. You subtract the minimum value from the maximum value.

150 - 120 = 30

Use the Intermediate Value Theorem to show that there is a root of the given equation in the specified interval.
x4 + x ? 7 = 0, (1, 2)
f(x) = x4 + x ? 7
is (FILL IN)
a) defined
b) continuous
c) negative
d) positive on the closed interval [1, 2],
f(1) = ?? FILL IN , and f(2) = ?? FILL IN
Since ?5 < FILL IN a)? b)? c)? d)0 < 11, there is a number c in (1, 2) such that
f(c) = FILL IN a)? b)? c)0 d)11 e)-5
by the Intermediate Value Theorem. Thus, there is a FILL IN a) limit b)root c) discontinuity of the equation
x4 + x ? 7 = 0
in the interval (1, 2).

Answers

Answer:

The correct option is  d

[tex]f(1) = -5[/tex]

[tex]f(2) = 11[/tex]

The correct option is d

The correct option is  c

the correct option is  b

Step-by-step explanation:

The given equation is

     [tex]f(x) = x^4 + x -7 =0[/tex]

The give interval  is [tex](1,2)[/tex]

 

   Now differentiating the equation

        [tex]f'(x) = 4x^3 +7 > 0[/tex]

Therefore the equation is  positive  at the given interval

       Now at x= 1

  [tex]f(1) = (1)^4 + 1 -7 =-5[/tex]

       Now at x= 2

  [tex]f(2) = (2)^4 + 2 -7 =11[/tex]

Now at  the interval (1,2)

      [tex]f(1) < 0 < f(2)[/tex]

i.e

      [tex]-5 < 0 < 11[/tex]

this tell us that there is a value z within 1,2 and

   f(z) =  0

Which implies that there is a root within (1,2) according to the intermediate value theorem

     

Which of the following points is in the solution set of y

Answers

Where is the picture

A bottler of drinking water fills plastic bottles with a mean volume of 1,007 milliliters (mL) and standard deviation The fill volumes are normally distributed. What proportion of bottles have volumes less than 1,007 mL?

Answers

Answer:

0.5 = 50% of bottles have volumes less than 1,007 mL

Step-by-step explanation:

Problems of normally distributed samples are solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the zscore of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the pvalue, we get the probability that the value of the measure is greater than X.

In this question, we have that:

[tex]\mu = 1007[/tex]

What proportion of bottles have volumes less than 1,007 mL?

This is the pvalue of Z when X = 1007. So

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]Z = \frac{1007 - 1007}{\sigma}[/tex]

[tex]Z = 0[/tex]

[tex]Z = 0[/tex] has a pvalue of 0.5

0.5 = 50% of bottles have volumes less than 1,007 mL

Help me plz
Find the area of the circle use 3.14 for pi

Answers

Answer:

530.93 cm thats what i got at least

Answer:

A =530.66 cm^2

Step-by-step explanation:

The area of a circle is given by

A = pi r^2

The radius is given by r =13

A = (3.14) (13)^2

A =530.66 cm^2

8. Nate bought two large pizzas and one small pizza and paid $36. If the difference in cost between a large and small pizza is $5.25, how much does a small pizza cost?

Answers

Answer:

$8.5

Step-by-step explanation:

We need to propose a system of equations with the information provided to us.

two large pizzas and one small pizza cost $36:

[tex]2L+S=36[/tex]

where

[tex]L[/tex]: Large pizza

[tex]S:[/tex] Small pizza

and the difference in cost between a large and small pizza is $5.25:

[tex]L-S=5.25[/tex]

our system of equations is:

[tex]2L+S=36[/tex]

[tex]L-S=5.25[/tex]

We are asked for the price of small pizza, so we must manipulate the equations in such a way that adding or subtracting them removes the variable L and we are left with an equation for S.

Multiply the second equation of the system by -2

[tex](-2)(L-S=5.25)\\\\-2L+2S=-10.5[/tex]

and now we sum this with the first equation of the system:

[tex]-2L+2S=-10.5\\+(2L+S=36)\\-------------\\-2L+2L+2S+S=-10.5+36[/tex]

simplifying the result:

[tex]3S=25.5[/tex]

and solving for S (the price of a small pizza)

[tex]S=25.5/3\\S=8.5[/tex]

Please answer this correctly

Answers

Answer:

# of broken crayons    # of boces

           1-5                            1

          6-10                          4

          11-15                          5

          16-20                        3

          21-25                         1

Step-by-step explanation:

1-5: 4 (1 number)

6-10: 6, 6, 8, 9 (4 numbers)

11-15: 12, 13, 14, 14, 15 (5 numbers)

16-20: 17, 17, 19 (3 numbers)

21-25: 24 (1 number)

Answer:

Number of broken crayons Number of boxes

1-5 = 4

6-10 = 9

11-15 = 14

16-20 =19

21-25 =24

Step-by-step explanation:

To find the number of boxes compared to the number of broken crayons you have to find 5 consecutive (hence there being five boxes to fill in) numbers with a constant rate of change. Start with the largest number possible that you can pick and then find the second largest so 24 and 19 the rate of change is 5. Compared to 17 and 19 the rate of change is 2 so it doesn’t have the same rate of change but if you try 19-5 you get 14 which is an option if you subtract 14-5 you get 9 which is another option 9-5 is 4 the lowest number you could possibly pick and they all have a constant rate of change of 5 so the answer is correct.

A hotel with 95 room has 65 for doubles and 25 for singles. Singles can be booked in any room, but reservations for two or more people must be booked in double rooms. Let x be the number for single reservations and y the reservations for two or more. Which system of inequality represents this situation? Click the correct answer y is greater than or equal to 65 x+y less than or equal to 95 y is less than or equal to 65 x+y less than or equal to 95 x is greater than or equal to 25 x+y less than or equal to 95 x is less than or equal to 25 x+y less than or equal to 95

Answers

Answer: Y is less than or equal to 65 and X + y= less than or equal to 95

A jury pool has 15 men and 21 women, from which 12 jurors will be selected. Assuming that each person is equally likely to be chosen and that the jury is selected at random, find the probability that the jury consists of:_____
(a) all men
(b) all women
(c) 8 men and 4 women
(d) 6 men and 6 women
Give all answers accurate to four decimal places.

Answers

Answer:

(a) all men = 3.6351 * 10^ -7

(b) all women = 2.3483* 10^ -4

(c) 8 men and 4 women = 0.0308

(d) 6 men and 6 women= 0.2170

Step-by-step explanation:

A jury pool has 15 men and 21 women, from which 12 jurors will be selected.

Total = 36 people

Probability of

(a) all men

= 15C12/36C12

= 455/1251677700

= 3.6351 * 10^ -7

(b) all women

= 21C12/36C12

= 293930/1251677700

= 2.3483* 10^ -4

(c) 8 men and 4 women

=( 15C8 * 21C4)/36C12

= (6435*5985)/1251677700

= 38513475/1251677700

= 0.0308

(d) 6 men and 6 women

= (15C6 * 21C6)/(36C12)

= (5005*54264)/1251677700

= 271591320/1251677700

= 0.2170

What’s the correct answer for this?

Answers

Answer:

B. The radius

Step-by-step explanation:

The area of a sector of a circle is ½ r² ∅, where r is the radius and ∅ the angle in radians subtended by the arc at the centre of the circle so we need to know the radius for it

Other Questions
Which of the following human activities does not increase the rate of erosion?A.deforestationB.the cultivation of less landC.urbanizationD.the use of land for grazing Our Lady of the Lake Hospital has assembled a group of employees to engage in planning activities. If the group comprises top executives such as the Chief Executive Officer, Chief Financial Officer, and Chief Marketing Officer, they would likely create what is tone created from What is angle m 2 ? What is angle m 1? Which of these nationalities ofpeople struggled with acceptancein immigrating to the UnitedStates at the turn of the century?A. EnglishB. GermanC. IrishD. Italian ASAP PLS! WILL MARK BRAINLYEST AND 6TH GRADE MATH The following ratios form a proportion.5\18 = 10/90True False Can someone pls help me solve this problem! I really need help ASAP! Plz help plz help! Stomach upset or rashes are examples of unwantedfrom some medicines, How does the first paragraph of The Dark Game best support the central idea that the Civil War was a long war?(AlbeO It shares the detail that the war lasted four years.O It states what people believed about the war at the time.O It tells how many soldiers actually died in the war.O. It gives an example of a battle that lasted almost two days. Write Python code to save the data to a MongoDB collection:Import json module to parse JSON dataImport MongoClient from pymongo to use MongoDBCreate a loop to iterate through the variable with data from Twitter, and for each tweet:Parse these related values: id, text, created_at, users screen_name, retweet_count, favorite_count, lang.Use MongoDBs insert method to add the parsed tweet values to MongoDB collection;Write Python code to query the database:Use find method to search for tweets with lang="en";Use the aggregate method with $sum to compute the total retweets;Use the aggregate method with $count and $group to count the number of tweets by each user (screen_name); How will you explain getting your life together? The lengths of pregnancies in a small rural village are normally distributed with a mean of 267 days and a standard deviation of 15 days. A distribution of values is normal with a mean of 267 and a standard deviation of 15. What percentage of pregnancies last beyond 246 days? P(X > 246 days) = A Car travels 42 kmOn 7 litres of petrol. How long will it travelon 12 litres of petrol. On July 8, Jones Inc. issued an $62,900, 9%, 120-day note payable to Miller Company. Assume that the fiscal year of Jones ends on July 31. Using the 360-day year, what is the amount of interest expense recognized by Jones in the current fiscal year hi can anybody give me the answer i will mark them as a brainliest Using the order of operations, what is the last calculation that should be done to evaluate 4(8 6)52 6 (3)?4(8 6)52 6 (3)4(2)52 6 (3)4(2)(25) 6 (3)200 6 (3)200 (2) What happens in the demilitarized zone? Jack is framing the roof of a structure using a triangle and two exterior angles.Which relationships about the interior and exterior angles are true? Check all that apply.a + b + c = 180x + a = 180a = ca + c = 90x + a = b + c Find the area of the following shapes: c